C32H49N3O8Si — CID 135024237
benzyl N-[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentan-2-yl]-N-(phenylmethoxycarbonylamino)carbamate (PubChem CID 135024237) has the molecular formula C32H49N3O8Si and a molecular weight of 631.84 g/mol. Its IUPAC name is benzyl N-[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentan-2-yl]-N-(phenylmethoxycarbonylamino)carbamate.
| Compound Name | benzyl N-[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentan-2-yl]-N-(phenylmethoxycarbonylamino)carbamate |
|---|---|
| PubChem CID | 135024237 |
| Molecular Formula | C32H49N3O8Si |
| Molecular Weight | 631.84 g/mol |
| Exact Mass | 631.33 |
| IUPAC Name | benzyl N-[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentan-2-yl]-N-(phenylmethoxycarbonylamino)carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@@H](C[C@@H](CO)N(NC(=O)OCc1ccccc1)C(=O)OCc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H49N3O8Si/c1-31(2,3)42-28(37)33-20-27(43-44(7,8)32(4,5)6)19-26(21-36)35(30(39)41-23-25-17-13-10-14-18-25)34-29(38)40-22-24-15-11-9-12-16-24/h9-18,26-27,36H,19-23H2,1-8H3,(H,33,37)(H,34,38)/t26-,27+/m0/s1 |
| InChIKey | RBAWOWFPTNQUMS-RRPNLBNLSA-N |
| XLogP | 6.13 |
| TPSA | 135.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.84 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|