C22H36N2O6Si — CID 10575644
benzyl (2S,3S)-4-amino-3-[tert-butyl(dimethyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate (PubChem CID 10575644) has the molecular formula C22H36N2O6Si and a molecular weight of 452.62 g/mol. Its IUPAC name is benzyl (2S,3S)-4-amino-3-[tert-butyl(dimethyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate.
| Compound Name | benzyl (2S,3S)-4-amino-3-[tert-butyl(dimethyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 10575644 |
| Molecular Formula | C22H36N2O6Si |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | benzyl (2S,3S)-4-amino-3-[tert-butyl(dimethyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(=O)OCc1ccccc1)[C@H](O[Si](C)(C)C(C)(C)C)C(N)=O |
| InChI | InChI=1S/C22H36N2O6Si/c1-21(2,3)29-20(27)24-16(19(26)28-14-15-12-10-9-11-13-15)17(18(23)25)30-31(7,8)22(4,5)6/h9-13,16-17H,14H2,1-8H3,(H2,23,25)(H,24,27)/t16-,17-/m0/s1 |
| InChIKey | DBPSELTVKCEATK-IRXDYDNUSA-N |
| XLogP | 3.50 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|