C37H57NO8Si — CID 135013763
benzyl (2R)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-[(2S,3R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxybutanoyl]oxyethyl]hexanoate (PubChem CID 135013763) has the molecular formula C37H57NO8Si and a molecular weight of 671.95 g/mol. Its IUPAC name is benzyl (2R)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-[(2S,3R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxybutanoyl]oxyethyl]hexanoate.
| Compound Name | benzyl (2R)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-[(2S,3R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxybutanoyl]oxyethyl]hexanoate |
|---|---|
| PubChem CID | 135013763 |
| Molecular Formula | C37H57NO8Si |
| Molecular Weight | 671.95 g/mol |
| Exact Mass | 671.39 |
| IUPAC Name | benzyl (2R)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-[(2S,3R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxybutanoyl]oxyethyl]hexanoate |
| SMILES | CCCC[C@@H](C(=O)OCc1ccccc1)[C@H](COC(=O)[C@@H](NC(=O)OC(C)(C)C)[C@@H](C)OCc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C37H57NO8Si/c1-11-12-23-30(33(39)43-25-29-21-17-14-18-22-29)31(46-47(9,10)37(6,7)8)26-44-34(40)32(38-35(41)45-36(3,4)5)27(2)42-24-28-19-15-13-16-20-28/h13-22,27,30-32H,11-12,23-26H2,1-10H3,(H,38,41)/t27-,30-,31+,32+/m1/s1 |
| InChIKey | KKYWFVPGZNFSMG-WBRFVXMESA-N |
| XLogP | 7.97 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.95 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|