C40H55NO8Si — CID 59653341
benzyl (2R,3S,4S)-2-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxypropanoyl]oxypentanoate (PubChem CID 59653341) has the molecular formula C40H55NO8Si and a molecular weight of 705.97 g/mol. Its IUPAC name is benzyl (2R,3S,4S)-2-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxypropanoyl]oxypentanoate.
| Compound Name | benzyl (2R,3S,4S)-2-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxypropanoyl]oxypentanoate |
|---|---|
| PubChem CID | 59653341 |
| Molecular Formula | C40H55NO8Si |
| Molecular Weight | 705.97 g/mol |
| Exact Mass | 705.37 |
| IUPAC Name | benzyl (2R,3S,4S)-2-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxypropanoyl]oxypentanoate |
| SMILES | C[C@H](OC(=O)C(COCc1ccccc1)NC(=O)OC(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](Cc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C40H55NO8Si/c1-29(47-37(43)34(41-38(44)48-39(2,3)4)28-45-26-31-21-15-11-16-22-31)35(49-50(8,9)40(5,6)7)33(25-30-19-13-10-14-20-30)36(42)46-27-32-23-17-12-18-24-32/h10-24,29,33-35H,25-28H2,1-9H3,(H,41,44)/t29-,33+,34?,35+/m0/s1 |
| InChIKey | QRWTXZKFELYOSH-CDXMDCTOSA-N |
| XLogP | 8.02 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.97 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|