C35H54ClNO7Si — CID 123258020
benzyl 3-[2-benzyl-3-[1-chloroethyl-di(propan-2-yl)silyl]oxy-4-hydroxypentoxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 123258020) has the molecular formula C35H54ClNO7Si and a molecular weight of 664.36 g/mol. Its IUPAC name is benzyl 3-[2-benzyl-3-[1-chloroethyl-di(propan-2-yl)silyl]oxy-4-hydroxypentoxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | benzyl 3-[2-benzyl-3-[1-chloroethyl-di(propan-2-yl)silyl]oxy-4-hydroxypentoxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 123258020 |
| Molecular Formula | C35H54ClNO7Si |
| Molecular Weight | 664.36 g/mol |
| Exact Mass | 663.34 |
| IUPAC Name | benzyl 3-[2-benzyl-3-[1-chloroethyl-di(propan-2-yl)silyl]oxy-4-hydroxypentoxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CC(O)C(O[Si](C(C)C)(C(C)C)C(C)Cl)C(COCC(NC(=O)OC(C)(C)C)C(=O)OCc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C35H54ClNO7Si/c1-24(2)45(25(3)4,27(6)36)44-32(26(5)38)30(20-28-16-12-10-13-17-28)22-41-23-31(37-34(40)43-35(7,8)9)33(39)42-21-29-18-14-11-15-19-29/h10-19,24-27,30-32,38H,20-23H2,1-9H3,(H,37,40) |
| InChIKey | ADJNQECVTBMNAJ-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.36 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|