C34H51N3O7Si — CID 162512544
benzyl 4-[(2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-phenylmethoxybutyl]piperazine-1-carboxylate (PubChem CID 162512544) has the molecular formula C34H51N3O7Si and a molecular weight of 641.88 g/mol. Its IUPAC name is benzyl 4-[(2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-phenylmethoxybutyl]piperazine-1-carboxylate.
| Compound Name | benzyl 4-[(2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-phenylmethoxybutyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 162512544 |
| Molecular Formula | C34H51N3O7Si |
| Molecular Weight | 641.88 g/mol |
| Exact Mass | 641.35 |
| IUPAC Name | benzyl 4-[(2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-phenylmethoxybutyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(=O)OCc1ccccc1)[C@H](CN1CCN(C(=O)OCc2ccccc2)CC1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H51N3O7Si/c1-33(2,3)43-31(39)35-29(30(38)41-24-26-15-11-9-12-16-26)28(44-45(7,8)34(4,5)6)23-36-19-21-37(22-20-36)32(40)42-25-27-17-13-10-14-18-27/h9-18,28-29H,19-25H2,1-8H3,(H,35,39)/t28-,29-/m0/s1 |
| InChIKey | OBMHEIUFJIOSGZ-VMPREFPWSA-N |
| XLogP | 5.97 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.88 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|