C20H31NO4 — CID 165468060
tert-butyl N-(5,5-dimethyl-4-oxo-2-phenylmethoxyhexan-3-yl)carbamate (PubChem CID 165468060) has the molecular formula C20H31NO4 and a molecular weight of 349.47 g/mol. Its IUPAC name is tert-butyl N-(5,5-dimethyl-4-oxo-2-phenylmethoxyhexan-3-yl)carbamate.
| Compound Name | tert-butyl N-(5,5-dimethyl-4-oxo-2-phenylmethoxyhexan-3-yl)carbamate |
|---|---|
| PubChem CID | 165468060 |
| Molecular Formula | C20H31NO4 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | tert-butyl N-(5,5-dimethyl-4-oxo-2-phenylmethoxyhexan-3-yl)carbamate |
| SMILES | CC(OCc1ccccc1)C(NC(=O)OC(C)(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C20H31NO4/c1-14(24-13-15-11-9-8-10-12-15)16(17(22)19(2,3)4)21-18(23)25-20(5,6)7/h8-12,14,16H,13H2,1-7H3,(H,21,23) |
| InChIKey | PTAAQXJEJOSQNA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |