C20H27NO4 — CID 165464970
tert-butyl N-[(2S,3R)-4-oxo-2-phenylmethoxyoct-7-yn-3-yl]carbamate (PubChem CID 165464970) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-4-oxo-2-phenylmethoxyoct-7-yn-3-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R)-4-oxo-2-phenylmethoxyoct-7-yn-3-yl]carbamate |
|---|---|
| PubChem CID | 165464970 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | tert-butyl N-[(2S,3R)-4-oxo-2-phenylmethoxyoct-7-yn-3-yl]carbamate |
| SMILES | C#CCCC(=O)[C@H](NC(=O)OC(C)(C)C)[C@H](C)OCc1ccccc1 |
| InChI | InChI=1S/C20H27NO4/c1-6-7-13-17(22)18(21-19(23)25-20(3,4)5)15(2)24-14-16-11-9-8-10-12-16/h1,8-12,15,18H,7,13-14H2,2-5H3,(H,21,23)/t15-,18+/m0/s1 |
| InChIKey | VWSGQQHREDTZDY-MAUKXSAKSA-N |
| XLogP | 3.47 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|