C46H75N3O11Si2 — CID 123229566
benzyl N-[2-[tert-butyl(dimethyl)silyl]oxybutyl]carbamate;benzyl N-[2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropyl]carbamate;benzyl N-(2,3-dihydroxypropyl)carbamate (PubChem CID 123229566) has the molecular formula C46H75N3O11Si2 and a molecular weight of 902.29 g/mol. Its IUPAC name is benzyl N-[2-[tert-butyl(dimethyl)silyl]oxybutyl]carbamate;benzyl N-[2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropyl]carbamate;benzyl N-(2,3-dihydroxypropyl)carbamate.
| Compound Name | benzyl N-[2-[tert-butyl(dimethyl)silyl]oxybutyl]carbamate;benzyl N-[2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropyl]carbamate;benzyl N-(2,3-dihydroxypropyl)carbamate |
|---|---|
| PubChem CID | 123229566 |
| Molecular Formula | C46H75N3O11Si2 |
| Molecular Weight | 902.29 g/mol |
| Exact Mass | 901.49 |
| IUPAC Name | benzyl N-[2-[tert-butyl(dimethyl)silyl]oxybutyl]carbamate;benzyl N-[2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropyl]carbamate;benzyl N-(2,3-dihydroxypropyl)carbamate |
| SMILES | CC(C)(C)[Si](C)(C)OC(CO)CNC(=O)OCc1ccccc1.CCC(CNC(=O)OCc1ccccc1)O[Si](C)(C)C(C)(C)C.O=C(NCC(O)CO)OCc1ccccc1 |
| InChI | InChI=1S/C18H31NO3Si.C17H29NO4Si.C11H15NO4/c1-7-16(22-23(5,6)18(2,3)4)13-19-17(20)21-14-15-11-9-8-10-12-15;1-17(2,3)23(4,5)22-15(12-19)11-18-16(20)21-13-14-9-7-6-8-10-14;13-7-10(14)6-12-11(15)16-8-9-4-2-1-3-5-9/h8-12,16H,7,13-14H2,1-6H3,(H,19,20);6-10,15,19H,11-13H2,1-5H3,(H,18,20);1-5,10,13-14H,6-8H2,(H,12,15) |
| InChIKey | UMYDZVPXOIISFR-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 194.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 62 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 902.29 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|