C18H22N2O4 — CID 168597249
benzyl N-[[4-(2,3-dihydroxypropylamino)phenyl]methyl]carbamate (PubChem CID 168597249) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is benzyl N-[[4-(2,3-dihydroxypropylamino)phenyl]methyl]carbamate.
| Compound Name | benzyl N-[[4-(2,3-dihydroxypropylamino)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 168597249 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | benzyl N-[[4-(2,3-dihydroxypropylamino)phenyl]methyl]carbamate |
| SMILES | O=C(NCc1ccc(NCC(O)CO)cc1)OCc1ccccc1 |
| InChI | InChI=1S/C18H22N2O4/c21-12-17(22)11-19-16-8-6-14(7-9-16)10-20-18(23)24-13-15-4-2-1-3-5-15/h1-9,17,19,21-22H,10-13H2,(H,20,23) |
| InChIKey | DBKSAOHUIKQOSW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |