C29H44N2O8Si — CID 135014421
benzyl N-[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-5,5-dimethoxypentan-2-yl]-N-(phenylmethoxycarbonylamino)carbamate (PubChem CID 135014421) has the molecular formula C29H44N2O8Si and a molecular weight of 576.76 g/mol. Its IUPAC name is benzyl N-[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-5,5-dimethoxypentan-2-yl]-N-(phenylmethoxycarbonylamino)carbamate.
| Compound Name | benzyl N-[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-5,5-dimethoxypentan-2-yl]-N-(phenylmethoxycarbonylamino)carbamate |
|---|---|
| PubChem CID | 135014421 |
| Molecular Formula | C29H44N2O8Si |
| Molecular Weight | 576.76 g/mol |
| Exact Mass | 576.29 |
| IUPAC Name | benzyl N-[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-5,5-dimethoxypentan-2-yl]-N-(phenylmethoxycarbonylamino)carbamate |
| SMILES | COC(C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CO)N(NC(=O)OCc1ccccc1)C(=O)OCc1ccccc1)OC |
| InChI | InChI=1S/C29H44N2O8Si/c1-29(2,3)40(6,7)39-25(18-26(35-4)36-5)24(19-32)31(28(34)38-21-23-16-12-9-13-17-23)30-27(33)37-20-22-14-10-8-11-15-22/h8-17,24-26,32H,18-21H2,1-7H3,(H,30,33)/t24-,25+/m0/s1 |
| InChIKey | CEDHLJUWINCBAZ-LOSJGSFVSA-N |
| XLogP | 5.23 |
| TPSA | 115.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.76 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|