C20H35NO5Si — CID 10668516
benzyl (2S,3S)-2-amino-3-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethoxypentanoate (PubChem CID 10668516) has the molecular formula C20H35NO5Si and a molecular weight of 397.59 g/mol. Its IUPAC name is benzyl (2S,3S)-2-amino-3-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethoxypentanoate.
| Compound Name | benzyl (2S,3S)-2-amino-3-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethoxypentanoate |
|---|---|
| PubChem CID | 10668516 |
| Molecular Formula | C20H35NO5Si |
| Molecular Weight | 397.59 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | benzyl (2S,3S)-2-amino-3-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethoxypentanoate |
| SMILES | COC(C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](N)C(=O)OCc1ccccc1)OC |
| InChI | InChI=1S/C20H35NO5Si/c1-20(2,3)27(6,7)26-16(13-17(23-4)24-5)18(21)19(22)25-14-15-11-9-8-10-12-15/h8-12,16-18H,13-14,21H2,1-7H3/t16-,18-/m0/s1 |
| InChIKey | MWJJOUGFTHJSQX-WMZOPIPTSA-N |
| XLogP | 3.46 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.59 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|