C31H35N3O8 — CID 59302378
methyl (2S,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenyl-2-[phenylmethoxycarbonyl(phenylmethoxycarbonylamino)amino]propanoate (PubChem CID 59302378) has the molecular formula C31H35N3O8 and a molecular weight of 577.63 g/mol. Its IUPAC name is methyl (2S,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenyl-2-[phenylmethoxycarbonyl(phenylmethoxycarbonylamino)amino]propanoate.
| Compound Name | methyl (2S,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenyl-2-[phenylmethoxycarbonyl(phenylmethoxycarbonylamino)amino]propanoate |
|---|---|
| PubChem CID | 59302378 |
| Molecular Formula | C31H35N3O8 |
| Molecular Weight | 577.63 g/mol |
| Exact Mass | 577.24 |
| IUPAC Name | methyl (2S,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenyl-2-[phenylmethoxycarbonyl(phenylmethoxycarbonylamino)amino]propanoate |
| SMILES | COC(=O)[C@H]([C@H](NC(=O)OC(C)(C)C)c1ccccc1)N(NC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H35N3O8/c1-31(2,3)42-28(36)32-25(24-18-12-7-13-19-24)26(27(35)39-4)34(30(38)41-21-23-16-10-6-11-17-23)33-29(37)40-20-22-14-8-5-9-15-22/h5-19,25-26H,20-21H2,1-4H3,(H,32,36)(H,33,37)/t25-,26+/m1/s1 |
| InChIKey | RZPMMJITRASODU-FTJBHMTQSA-N |
| XLogP | 5.27 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.63 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|