C20H38N4O4Si — CID 68628541
tert-butyl N-[3-[(3-amino-6-methoxy-2-pyridinyl)amino]-2-[tert-butyl(dimethyl)silyl]oxypropyl]carbamate (PubChem CID 68628541) has the molecular formula C20H38N4O4Si and a molecular weight of 426.63 g/mol. Its IUPAC name is tert-butyl N-[3-[(3-amino-6-methoxy-2-pyridinyl)amino]-2-[tert-butyl(dimethyl)silyl]oxypropyl]carbamate.
| Compound Name | tert-butyl N-[3-[(3-amino-6-methoxy-2-pyridinyl)amino]-2-[tert-butyl(dimethyl)silyl]oxypropyl]carbamate |
|---|---|
| PubChem CID | 68628541 |
| Molecular Formula | C20H38N4O4Si |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | tert-butyl N-[3-[(3-amino-6-methoxy-2-pyridinyl)amino]-2-[tert-butyl(dimethyl)silyl]oxypropyl]carbamate |
| SMILES | COc1ccc(N)c(NCC(CNC(=O)OC(C)(C)C)O[Si](C)(C)C(C)(C)C)n1 |
| InChI | InChI=1S/C20H38N4O4Si/c1-19(2,3)27-18(25)23-13-14(28-29(8,9)20(4,5)6)12-22-17-15(21)10-11-16(24-17)26-7/h10-11,14H,12-13,21H2,1-9H3,(H,22,24)(H,23,25) |
| InChIKey | RGCILGDAUVAIFP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 107.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|