C29H38Cl3NO8 — CID 59922965
[(4S,5S,6R,9S,10S)-11-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-9-hydroxy-4,6,8,8,10-pentamethyl-7,11-dioxoundec-1-en-5-yl] 2,2,2-trichloroethyl carbonate (PubChem CID 59922965) has the molecular formula C29H38Cl3NO8 and a molecular weight of 634.98 g/mol. Its IUPAC name is [(4S,5S,6R,9S,10S)-11-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-9-hydroxy-4,6,8,8,10-pentamethyl-7,11-dioxoundec-1-en-5-yl] 2,2,2-trichloroethyl carbonate.
| Compound Name | [(4S,5S,6R,9S,10S)-11-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-9-hydroxy-4,6,8,8,10-pentamethyl-7,11-dioxoundec-1-en-5-yl] 2,2,2-trichloroethyl carbonate |
|---|---|
| PubChem CID | 59922965 |
| Molecular Formula | C29H38Cl3NO8 |
| Molecular Weight | 634.98 g/mol |
| Exact Mass | 633.17 |
| IUPAC Name | [(4S,5S,6R,9S,10S)-11-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-9-hydroxy-4,6,8,8,10-pentamethyl-7,11-dioxoundec-1-en-5-yl] 2,2,2-trichloroethyl carbonate |
| SMILES | C=CC[C@H](C)[C@H](OC(=O)OCC(Cl)(Cl)Cl)[C@@H](C)C(=O)C(C)(C)[C@@H](O)[C@H](C)C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C29H38Cl3NO8/c1-7-11-17(2)22(41-27(38)40-16-29(30,31)32)18(3)23(34)28(5,6)24(35)19(4)25(36)33-21(15-39-26(33)37)14-20-12-9-8-10-13-20/h7-10,12-13,17-19,21-22,24,35H,1,11,14-16H2,2-6H3/t17-,18+,19-,21-,22-,24-/m0/s1 |
| InChIKey | DYVKYGSMMRPCIQ-KNVDOIHLSA-N |
| XLogP | 5.91 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.98 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|