C46H86ClNO5Si3 — CID 57224576
(3S,6R,7S,8S,15S)-3,7,15-tris[[tert-butyl(dimethyl)silyl]oxy]-16-chloro-6-ethyl-1-hydroxy-4,4,8,12-tetramethyl-17-pyridin-2-ylheptadeca-12,16-dien-5-one (PubChem CID 57224576) has the molecular formula C46H86ClNO5Si3 and a molecular weight of 852.91 g/mol. Its IUPAC name is (3S,6R,7S,8S,15S)-3,7,15-tris[[tert-butyl(dimethyl)silyl]oxy]-16-chloro-6-ethyl-1-hydroxy-4,4,8,12-tetramethyl-17-pyridin-2-ylheptadeca-12,16-dien-5-one.
| Compound Name | (3S,6R,7S,8S,15S)-3,7,15-tris[[tert-butyl(dimethyl)silyl]oxy]-16-chloro-6-ethyl-1-hydroxy-4,4,8,12-tetramethyl-17-pyridin-2-ylheptadeca-12,16-dien-5-one |
|---|---|
| PubChem CID | 57224576 |
| Molecular Formula | C46H86ClNO5Si3 |
| Molecular Weight | 852.91 g/mol |
| Exact Mass | 851.55 |
| IUPAC Name | (3S,6R,7S,8S,15S)-3,7,15-tris[[tert-butyl(dimethyl)silyl]oxy]-16-chloro-6-ethyl-1-hydroxy-4,4,8,12-tetramethyl-17-pyridin-2-ylheptadeca-12,16-dien-5-one |
| SMILES | CC[C@@H](C(=O)C(C)(C)[C@H](CCO)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CCCC(C)=CC[C@H](O[Si](C)(C)C(C)(C)C)C(Cl)=Cc1ccccn1 |
| InChI | InChI=1S/C46H86ClNO5Si3/c1-21-37(42(50)46(13,14)40(30-32-49)52-55(17,18)44(7,8)9)41(53-56(19,20)45(10,11)12)35(3)26-24-25-34(2)28-29-39(51-54(15,16)43(4,5)6)38(47)33-36-27-22-23-31-48-36/h22-23,27-28,31,33,35,37,39-41,49H,21,24-26,29-30,32H2,1-20H3/t35-,37+,39-,40-,41-/m0/s1 |
| InChIKey | SXGADPXTENSAPK-GCKCWUSBSA-N |
| XLogP | 13.98 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.91 |
| LogP ≤ 5 | 13.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|