C46H84FNO5Si3 — CID 142651797
3,7,15-tris[[tert-butyl(dimethyl)silyl]oxy]-6-ethyl-16-fluoro-4,4,8,12-tetramethyl-5-oxo-17-pyridin-2-ylheptadeca-12,16-dienal (PubChem CID 142651797) has the molecular formula C46H84FNO5Si3 and a molecular weight of 834.44 g/mol. Its IUPAC name is 3,7,15-tris[[tert-butyl(dimethyl)silyl]oxy]-6-ethyl-16-fluoro-4,4,8,12-tetramethyl-5-oxo-17-pyridin-2-ylheptadeca-12,16-dienal.
| Compound Name | 3,7,15-tris[[tert-butyl(dimethyl)silyl]oxy]-6-ethyl-16-fluoro-4,4,8,12-tetramethyl-5-oxo-17-pyridin-2-ylheptadeca-12,16-dienal |
|---|---|
| PubChem CID | 142651797 |
| Molecular Formula | C46H84FNO5Si3 |
| Molecular Weight | 834.44 g/mol |
| Exact Mass | 833.56 |
| IUPAC Name | 3,7,15-tris[[tert-butyl(dimethyl)silyl]oxy]-6-ethyl-16-fluoro-4,4,8,12-tetramethyl-5-oxo-17-pyridin-2-ylheptadeca-12,16-dienal |
| SMILES | CCC(C(=O)C(C)(C)C(CC=O)O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(C)CCCC(C)=CCC(O[Si](C)(C)C(C)(C)C)C(F)=Cc1ccccn1 |
| InChI | InChI=1S/C46H84FNO5Si3/c1-21-37(42(50)46(13,14)40(30-32-49)52-55(17,18)44(7,8)9)41(53-56(19,20)45(10,11)12)35(3)26-24-25-34(2)28-29-39(51-54(15,16)43(4,5)6)38(47)33-36-27-22-23-31-48-36/h22-23,27-28,31-33,35,37,39-41H,21,24-26,29-30H2,1-20H3 |
| InChIKey | QDKDZHXECBLFHJ-UHFFFAOYSA-N |
| XLogP | 13.92 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.44 |
| LogP ≤ 5 | 13.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|