C37H62FNO5Si — CID 90824651
(5S,6S,13S)-13-[tert-butyl(dimethyl)silyl]oxy-2-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-4-ethyl-14-fluoro-5-hydroxy-2,6,10-trimethyl-1-pyridin-2-ylpentadeca-10,14-dien-3-one (PubChem CID 90824651) has the molecular formula C37H62FNO5Si and a molecular weight of 647.99 g/mol. Its IUPAC name is (5S,6S,13S)-13-[tert-butyl(dimethyl)silyl]oxy-2-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-4-ethyl-14-fluoro-5-hydroxy-2,6,10-trimethyl-1-pyridin-2-ylpentadeca-10,14-dien-3-one.
| Compound Name | (5S,6S,13S)-13-[tert-butyl(dimethyl)silyl]oxy-2-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-4-ethyl-14-fluoro-5-hydroxy-2,6,10-trimethyl-1-pyridin-2-ylpentadeca-10,14-dien-3-one |
|---|---|
| PubChem CID | 90824651 |
| Molecular Formula | C37H62FNO5Si |
| Molecular Weight | 647.99 g/mol |
| Exact Mass | 647.44 |
| IUPAC Name | (5S,6S,13S)-13-[tert-butyl(dimethyl)silyl]oxy-2-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-4-ethyl-14-fluoro-5-hydroxy-2,6,10-trimethyl-1-pyridin-2-ylpentadeca-10,14-dien-3-one |
| SMILES | C=C(F)[C@H](CC=C(C)CCC[C@H](C)[C@H](O)C(CC)C(=O)C(C)(Cc1ccccn1)[C@@H]1CCOC(C)(C)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C37H62FNO5Si/c1-13-30(34(41)37(10,25-29-19-14-15-23-39-29)32-22-24-42-36(8,9)43-32)33(40)27(3)18-16-17-26(2)20-21-31(28(4)38)44-45(11,12)35(5,6)7/h14-15,19-20,23,27,30-33,40H,4,13,16-18,21-22,24-25H2,1-3,5-12H3/t27-,30?,31-,32-,33-,37?/m0/s1 |
| InChIKey | IGORFDSLRFRGPU-VEMJTPOBSA-N |
| XLogP | 9.14 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.99 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|