C20H36O4 — CID 10914782
(4R,5S,6S)-2-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-5-hydroxy-2,4,6-trimethylundec-10-en-3-one (PubChem CID 10914782) has the molecular formula C20H36O4 and a molecular weight of 340.50 g/mol. Its IUPAC name is (4R,5S,6S)-2-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-5-hydroxy-2,4,6-trimethylundec-10-en-3-one.
| Compound Name | (4R,5S,6S)-2-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-5-hydroxy-2,4,6-trimethylundec-10-en-3-one |
|---|---|
| PubChem CID | 10914782 |
| Molecular Formula | C20H36O4 |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | (4R,5S,6S)-2-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-5-hydroxy-2,4,6-trimethylundec-10-en-3-one |
| SMILES | C=CCCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H]1CCOC(C)(C)O1 |
| InChI | InChI=1S/C20H36O4/c1-8-9-10-11-14(2)17(21)15(3)18(22)19(4,5)16-12-13-23-20(6,7)24-16/h8,14-17,21H,1,9-13H2,2-7H3/t14-,15+,16-,17-/m0/s1 |
| InChIKey | SERRAVGJLNKDMA-YVSFHVDLSA-N |
| XLogP | 4.11 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|