C11H22O2 — CID 141061915
(4S)-2,2-dimethyl-4-(2-methylbutan-2-yl)-1,3-dioxane (PubChem CID 141061915) has the molecular formula C11H22O2 and a molecular weight of 186.29 g/mol. Its IUPAC name is (4S)-2,2-dimethyl-4-(2-methylbutan-2-yl)-1,3-dioxane.
| Compound Name | (4S)-2,2-dimethyl-4-(2-methylbutan-2-yl)-1,3-dioxane |
|---|---|
| PubChem CID | 141061915 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | (4S)-2,2-dimethyl-4-(2-methylbutan-2-yl)-1,3-dioxane |
| SMILES | CCC(C)(C)[C@@H]1CCOC(C)(C)O1 |
| InChI | InChI=1S/C11H22O2/c1-6-10(2,3)9-7-8-12-11(4,5)13-9/h9H,6-8H2,1-5H3/t9-/m0/s1 |
| InChIKey | AZLPCBYXQBLCRA-VIFPVBQESA-N |
| XLogP | 2.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |