C10H24O2 — CID 143842052
2,2-dimethyl-1,3-dioxolane;ethane;propane (PubChem CID 143842052) has the molecular formula C10H24O2 and a molecular weight of 176.30 g/mol. Its IUPAC name is 2,2-dimethyl-1,3-dioxolane;ethane;propane.
| Compound Name | 2,2-dimethyl-1,3-dioxolane;ethane;propane |
|---|---|
| PubChem CID | 143842052 |
| Molecular Formula | C10H24O2 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.18 |
| IUPAC Name | 2,2-dimethyl-1,3-dioxolane;ethane;propane |
| SMILES | CC.CC1(C)OCCO1.CCC |
| InChI | InChI=1S/C5H10O2.C3H8.C2H6/c1-5(2)6-3-4-7-5;1-3-2;1-2/h3-4H2,1-2H3;3H2,1-2H3;1-2H3 |
| InChIKey | FOCZIEVACVQUCB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |