C8H16O4 — CID 158752243
2,2-dimethyl-1,3-dioxolane;1,3-dioxolane (PubChem CID 158752243) has the molecular formula C8H16O4 and a molecular weight of 176.21 g/mol. Its IUPAC name is 2,2-dimethyl-1,3-dioxolane;1,3-dioxolane.
| Compound Name | 2,2-dimethyl-1,3-dioxolane;1,3-dioxolane |
|---|---|
| PubChem CID | 158752243 |
| Molecular Formula | C8H16O4 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | 2,2-dimethyl-1,3-dioxolane;1,3-dioxolane |
| SMILES | C1COCO1.CC1(C)OCCO1 |
| InChI | InChI=1S/C5H10O2.C3H6O2/c1-5(2)6-3-4-7-5;1-2-5-3-4-1/h3-4H2,1-2H3;1-3H2 |
| InChIKey | INPYTEWHPFIQIZ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |