C7H14O2 — CID 21332866
2-ethyl-2-methyl-1,4-dioxane (PubChem CID 21332866) has the molecular formula C7H14O2 and a molecular weight of 130.19 g/mol. Its IUPAC name is 2-ethyl-2-methyl-1,4-dioxane.
| Compound Name | 2-ethyl-2-methyl-1,4-dioxane |
|---|---|
| PubChem CID | 21332866 |
| Molecular Formula | C7H14O2 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | 2-ethyl-2-methyl-1,4-dioxane |
| SMILES | CCC1(C)COCCO1 |
| InChI | InChI=1S/C7H14O2/c1-3-7(2)6-8-4-5-9-7/h3-6H2,1-2H3 |
| InChIKey | MCSJBDKPBUJIOI-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |