C22H42O8 — CID 14205915
12-ethyl-12-(12-ethyl-1,4,7,10-tetraoxacyclotridec-12-yl)-1,4,7,10-tetraoxacyclotridecane (PubChem CID 14205915) has the molecular formula C22H42O8 and a molecular weight of 434.57 g/mol. Its IUPAC name is 12-ethyl-12-(12-ethyl-1,4,7,10-tetraoxacyclotridec-12-yl)-1,4,7,10-tetraoxacyclotridecane.
| Compound Name | 12-ethyl-12-(12-ethyl-1,4,7,10-tetraoxacyclotridec-12-yl)-1,4,7,10-tetraoxacyclotridecane |
|---|---|
| PubChem CID | 14205915 |
| Molecular Formula | C22H42O8 |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | 12-ethyl-12-(12-ethyl-1,4,7,10-tetraoxacyclotridec-12-yl)-1,4,7,10-tetraoxacyclotridecane |
| SMILES | CCC1(C2(CC)COCCOCCOCCOC2)COCCOCCOCCOC1 |
| InChI | InChI=1S/C22H42O8/c1-3-21(17-27-13-9-23-5-6-24-10-14-28-18-21)22(4-2)19-29-15-11-25-7-8-26-12-16-30-20-22/h3-20H2,1-2H3 |
| InChIKey | YVHIJFCUCYTCRU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |