About (2-ethyl-1,7,10-trioxaspiro[4.6]undecan-2-yl)methanol
(2-ethyl-1,7,10-trioxaspiro[4.6]undecan-2-yl)methanol (PubChem CID 13237163) has the molecular formula C11H20O4
and a molecular weight of 216.28 g/mol. Its IUPAC name is (2-ethyl-1,7,10-trioxaspiro[4.6]undecan-2-yl)methanol.
Analyze (2-ethyl-1,7,10-trioxaspiro[4.6]undecan-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethyl-1,7,10-trioxaspiro[4.6]undecan-2-yl)methanol?
The IUPAC name of (2-ethyl-1,7,10-trioxaspiro[4.6]undecan-2-yl)methanol (CID 13237163) is (2-ethyl-1,7,10-trioxaspiro[4.6]undecan-2-yl)methanol.
What is the SMILES notation for (2-ethyl-1,7,10-trioxaspiro[4.6]undecan-2-yl)methanol?
The canonical SMILES for (2-ethyl-1,7,10-trioxaspiro[4.6]undecan-2-yl)methanol is CCC1(CO)CCC2(COCCOC2)O1.
What is the InChIKey of (2-ethyl-1,7,10-trioxaspiro[4.6]undecan-2-yl)methanol?
The InChIKey is HUDLEZSAAFCJPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O4/c1-2-10(7-12)3-4-11(15-10)8-13-5-6-14-9-11/h12H,2-9H2,1H3.
What are the key properties of (2-ethyl-1,7,10-trioxaspiro[4.6]undecan-2-yl)methanol?
(2-ethyl-1,7,10-trioxaspiro[4.6]undecan-2-yl)methanol has a molecular weight of 216.28 g/mol, XLogP of 0.72, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethyl-1,7,10-trioxaspiro[4.6]undecan-2-yl)methanol is sourced from PubChem (CID 13237163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).