C9H19NO3 — CID 57290104
[2-(1-aminobutyl)-1,4-dioxan-2-yl]methanol (PubChem CID 57290104) has the molecular formula C9H19NO3 and a molecular weight of 189.25 g/mol. Its IUPAC name is [2-(1-aminobutyl)-1,4-dioxan-2-yl]methanol.
| Compound Name | [2-(1-aminobutyl)-1,4-dioxan-2-yl]methanol |
|---|---|
| PubChem CID | 57290104 |
| Molecular Formula | C9H19NO3 |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | [2-(1-aminobutyl)-1,4-dioxan-2-yl]methanol |
| SMILES | CCCC(N)C1(CO)COCCO1 |
| InChI | InChI=1S/C9H19NO3/c1-2-3-8(10)9(6-11)7-12-4-5-13-9/h8,11H,2-7,10H2,1H3 |
| InChIKey | UBWVOFHBOJDZDO-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |