C9H18O4 — CID 53310343
[(3R,5S)-3,5-diethyl-5-(hydroxymethyl)dioxolan-3-yl]methanol (PubChem CID 53310343) has the molecular formula C9H18O4 and a molecular weight of 190.24 g/mol. Its IUPAC name is [(3R,5S)-3,5-diethyl-5-(hydroxymethyl)dioxolan-3-yl]methanol.
| Compound Name | [(3R,5S)-3,5-diethyl-5-(hydroxymethyl)dioxolan-3-yl]methanol |
|---|---|
| PubChem CID | 53310343 |
| Molecular Formula | C9H18O4 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | [(3R,5S)-3,5-diethyl-5-(hydroxymethyl)dioxolan-3-yl]methanol |
| SMILES | CC[C@]1(CO)C[C@@](CC)(CO)OO1 |
| InChI | InChI=1S/C9H18O4/c1-3-8(6-10)5-9(4-2,7-11)13-12-8/h10-11H,3-7H2,1-2H3/t8-,9+ |
| InChIKey | KEAKQIZFZPVDCX-DTORHVGOSA-N |
| XLogP | 0.62 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|