About 2-ethyl-2-methyl-1,9-dioxa-4-azaspiro[5.5]undecane
2-ethyl-2-methyl-1,9-dioxa-4-azaspiro[5.5]undecane (PubChem CID 114497305) has the molecular formula C11H21NO2
and a molecular weight of 199.29 g/mol. Its IUPAC name is 2-ethyl-2-methyl-1,9-dioxa-4-azaspiro[5.5]undecane.
Molecular Properties
| Compound Name | 2-ethyl-2-methyl-1,9-dioxa-4-azaspiro[5.5]undecane |
| PubChem CID | 114497305 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | 2-ethyl-2-methyl-1,9-dioxa-4-azaspiro[5.5]undecane |
| SMILES | CCC1(C)CNCC2(CCOCC2)O1 |
| InChI | InChI=1S/C11H21NO2/c1-3-10(2)8-12-9-11(14-10)4-6-13-7-5-11/h12H,3-9H2,1-2H3 |
| InChIKey | YEENZWLJBKECRV-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-2-methyl-1,9-dioxa-4-azaspiro[5.5]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2-methyl-1,9-dioxa-4-azaspiro[5.5]undecane?
The IUPAC name of 2-ethyl-2-methyl-1,9-dioxa-4-azaspiro[5.5]undecane (CID 114497305) is 2-ethyl-2-methyl-1,9-dioxa-4-azaspiro[5.5]undecane.
What is the SMILES notation for 2-ethyl-2-methyl-1,9-dioxa-4-azaspiro[5.5]undecane?
The canonical SMILES for 2-ethyl-2-methyl-1,9-dioxa-4-azaspiro[5.5]undecane is CCC1(C)CNCC2(CCOCC2)O1.
What is the InChIKey of 2-ethyl-2-methyl-1,9-dioxa-4-azaspiro[5.5]undecane?
The InChIKey is YEENZWLJBKECRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO2/c1-3-10(2)8-12-9-11(14-10)4-6-13-7-5-11/h12H,3-9H2,1-2H3.
What are the key properties of 2-ethyl-2-methyl-1,9-dioxa-4-azaspiro[5.5]undecane?
2-ethyl-2-methyl-1,9-dioxa-4-azaspiro[5.5]undecane has a molecular weight of 199.29 g/mol, XLogP of 1.32, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2-methyl-1,9-dioxa-4-azaspiro[5.5]undecane is sourced from PubChem (CID 114497305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).