C13H25NO2 — CID 114497562
2-methyl-2-propan-2-yl-1,10-dioxa-4-azaspiro[5.6]dodecane (PubChem CID 114497562) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is 2-methyl-2-propan-2-yl-1,10-dioxa-4-azaspiro[5.6]dodecane.
| Compound Name | 2-methyl-2-propan-2-yl-1,10-dioxa-4-azaspiro[5.6]dodecane |
|---|---|
| PubChem CID | 114497562 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | 2-methyl-2-propan-2-yl-1,10-dioxa-4-azaspiro[5.6]dodecane |
| SMILES | CC(C)C1(C)CNCC2(CCCOCC2)O1 |
| InChI | InChI=1S/C13H25NO2/c1-11(2)12(3)9-14-10-13(16-12)5-4-7-15-8-6-13/h11,14H,4-10H2,1-3H3 |
| InChIKey | DRWVQNQUTMSOKZ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |