C13H26O6 — CID 102268049
2-(2-methoxyethoxymethyl)-2-methyl-1,4,7,10-tetraoxacyclododecane (PubChem CID 102268049) has the molecular formula C13H26O6 and a molecular weight of 278.34 g/mol. Its IUPAC name is 2-(2-methoxyethoxymethyl)-2-methyl-1,4,7,10-tetraoxacyclododecane.
| Compound Name | 2-(2-methoxyethoxymethyl)-2-methyl-1,4,7,10-tetraoxacyclododecane |
|---|---|
| PubChem CID | 102268049 |
| Molecular Formula | C13H26O6 |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 2-(2-methoxyethoxymethyl)-2-methyl-1,4,7,10-tetraoxacyclododecane |
| SMILES | COCCOCC1(C)COCCOCCOCCO1 |
| InChI | InChI=1S/C13H26O6/c1-13(11-17-4-3-14-2)12-18-8-7-15-5-6-16-9-10-19-13/h3-12H2,1-2H3 |
| InChIKey | VUFUPKXLVTVLHH-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|