C18H34O8 — CID 10022548
12-methyl-12-[2-[2-(oxiran-2-ylmethoxy)ethoxy]ethoxymethyl]-1,4,7,10-tetraoxacyclotridecane (PubChem CID 10022548) has the molecular formula C18H34O8 and a molecular weight of 378.46 g/mol. Its IUPAC name is 12-methyl-12-[2-[2-(oxiran-2-ylmethoxy)ethoxy]ethoxymethyl]-1,4,7,10-tetraoxacyclotridecane.
| Compound Name | 12-methyl-12-[2-[2-(oxiran-2-ylmethoxy)ethoxy]ethoxymethyl]-1,4,7,10-tetraoxacyclotridecane |
|---|---|
| PubChem CID | 10022548 |
| Molecular Formula | C18H34O8 |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 12-methyl-12-[2-[2-(oxiran-2-ylmethoxy)ethoxy]ethoxymethyl]-1,4,7,10-tetraoxacyclotridecane |
| SMILES | CC1(COCCOCCOCC2CO2)COCCOCCOCCOC1 |
| InChI | InChI=1S/C18H34O8/c1-18(14-23-9-5-19-2-3-20-6-10-24-15-18)16-25-11-7-21-4-8-22-12-17-13-26-17/h17H,2-16H2,1H3 |
| InChIKey | PREHRURXGABQLI-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 77.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|