C6H12O4 — CID 142542540
2,2-dimethyl-1,3-dioxolane;formic acid (PubChem CID 142542540) has the molecular formula C6H12O4 and a molecular weight of 148.16 g/mol. Its IUPAC name is 2,2-dimethyl-1,3-dioxolane;formic acid.
| Compound Name | 2,2-dimethyl-1,3-dioxolane;formic acid |
|---|---|
| PubChem CID | 142542540 |
| Molecular Formula | C6H12O4 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 2,2-dimethyl-1,3-dioxolane;formic acid |
| SMILES | CC1(C)OCCO1.O=CO |
| InChI | InChI=1S/C5H10O2.CH2O2/c1-5(2)6-3-4-7-5;2-1-3/h3-4H2,1-2H3;1H,(H,2,3) |
| InChIKey | RAIZCCSSFWAJDL-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|