C43H64O5Si — CID 162065682
(4R,6S)-4-benzyl-10-[tert-butyl(diphenyl)silyl]oxy-2-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-5-hydroxy-2,6-dimethylundecan-3-one;methane (PubChem CID 162065682) has the molecular formula C43H64O5Si and a molecular weight of 689.07 g/mol. Its IUPAC name is (4R,6S)-4-benzyl-10-[tert-butyl(diphenyl)silyl]oxy-2-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-5-hydroxy-2,6-dimethylundecan-3-one;methane.
| Compound Name | (4R,6S)-4-benzyl-10-[tert-butyl(diphenyl)silyl]oxy-2-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-5-hydroxy-2,6-dimethylundecan-3-one;methane |
|---|---|
| PubChem CID | 162065682 |
| Molecular Formula | C43H64O5Si |
| Molecular Weight | 689.07 g/mol |
| Exact Mass | 688.45 |
| IUPAC Name | (4R,6S)-4-benzyl-10-[tert-butyl(diphenyl)silyl]oxy-2-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-5-hydroxy-2,6-dimethylundecan-3-one;methane |
| SMILES | C.CC(CCC[C@H](C)C(O)[C@@H](Cc1ccccc1)C(=O)C(C)(C)[C@@H]1CCOC(C)(C)O1)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C42H60O5Si.CH4/c1-31(20-19-21-32(2)47-48(40(3,4)5,34-24-15-11-16-25-34)35-26-17-12-18-27-35)38(43)36(30-33-22-13-10-14-23-33)39(44)41(6,7)37-28-29-45-42(8,9)46-37;/h10-18,22-27,31-32,36-38,43H,19-21,28-30H2,1-9H3;1H4/t31-,32?,36+,37-,38?;/m0./s1 |
| InChIKey | ZAKQOXMIXSBYSF-UXNXXJLGSA-N |
| XLogP | 8.75 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.07 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|