C45H74O6Si2 — CID 71192174
(4R,6S)-10-[tert-butyl(diphenyl)silyl]oxy-2-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-2,6-dimethyl-5-(oxan-2-yloxy)-4-(2-trimethylsilylethyl)undecan-3-one (PubChem CID 71192174) has the molecular formula C45H74O6Si2 and a molecular weight of 767.25 g/mol. Its IUPAC name is (4R,6S)-10-[tert-butyl(diphenyl)silyl]oxy-2-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-2,6-dimethyl-5-(oxan-2-yloxy)-4-(2-trimethylsilylethyl)undecan-3-one.
| Compound Name | (4R,6S)-10-[tert-butyl(diphenyl)silyl]oxy-2-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-2,6-dimethyl-5-(oxan-2-yloxy)-4-(2-trimethylsilylethyl)undecan-3-one |
|---|---|
| PubChem CID | 71192174 |
| Molecular Formula | C45H74O6Si2 |
| Molecular Weight | 767.25 g/mol |
| Exact Mass | 766.50 |
| IUPAC Name | (4R,6S)-10-[tert-butyl(diphenyl)silyl]oxy-2-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-2,6-dimethyl-5-(oxan-2-yloxy)-4-(2-trimethylsilylethyl)undecan-3-one |
| SMILES | CC(CCC[C@H](C)C(OC1CCCCO1)[C@@H](CC[Si](C)(C)C)C(=O)C(C)(C)[C@@H]1CCOC(C)(C)O1)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C45H74O6Si2/c1-34(22-21-23-35(2)51-53(43(3,4)5,36-24-15-13-16-25-36)37-26-17-14-18-27-37)41(49-40-28-19-20-31-47-40)38(30-33-52(10,11)12)42(46)44(6,7)39-29-32-48-45(8,9)50-39/h13-18,24-27,34-35,38-41H,19-23,28-33H2,1-12H3/t34-,35?,38+,39-,40?,41?/m0/s1 |
| InChIKey | HHZNFPRQTROREF-QTZQLKQGSA-N |
| XLogP | 10.15 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.25 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|