C31H46O5Si — CID 11642220
ethyl (4R,5S)-5-[(6R)-6-[tert-butyl(diphenyl)silyl]oxyheptyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate (PubChem CID 11642220) has the molecular formula C31H46O5Si and a molecular weight of 526.79 g/mol. Its IUPAC name is ethyl (4R,5S)-5-[(6R)-6-[tert-butyl(diphenyl)silyl]oxyheptyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate.
| Compound Name | ethyl (4R,5S)-5-[(6R)-6-[tert-butyl(diphenyl)silyl]oxyheptyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 11642220 |
| Molecular Formula | C31H46O5Si |
| Molecular Weight | 526.79 g/mol |
| Exact Mass | 526.31 |
| IUPAC Name | ethyl (4R,5S)-5-[(6R)-6-[tert-butyl(diphenyl)silyl]oxyheptyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
| SMILES | CCOC(=O)[C@@H]1OC(C)(C)O[C@H]1CCCCC[C@@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C31H46O5Si/c1-8-33-29(32)28-27(34-31(6,7)35-28)23-17-9-12-18-24(2)36-37(30(3,4)5,25-19-13-10-14-20-25)26-21-15-11-16-22-26/h10-11,13-16,19-22,24,27-28H,8-9,12,17-18,23H2,1-7H3/t24-,27+,28-/m1/s1 |
| InChIKey | KFBARGBFYAKZSF-FQLPYIGMSA-N |
| XLogP | 5.99 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.79 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|