C25H50O5Si — CID 102230656
ethyl (4R,5S)-5-[(2R)-2-[tert-butyl(dimethyl)silyl]oxyundecyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate (PubChem CID 102230656) has the molecular formula C25H50O5Si and a molecular weight of 458.76 g/mol. Its IUPAC name is ethyl (4R,5S)-5-[(2R)-2-[tert-butyl(dimethyl)silyl]oxyundecyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate.
| Compound Name | ethyl (4R,5S)-5-[(2R)-2-[tert-butyl(dimethyl)silyl]oxyundecyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 102230656 |
| Molecular Formula | C25H50O5Si |
| Molecular Weight | 458.76 g/mol |
| Exact Mass | 458.34 |
| IUPAC Name | ethyl (4R,5S)-5-[(2R)-2-[tert-butyl(dimethyl)silyl]oxyundecyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
| SMILES | CCCCCCCCC[C@H](C[C@@H]1OC(C)(C)O[C@H]1C(=O)OCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H50O5Si/c1-10-12-13-14-15-16-17-18-20(30-31(8,9)24(3,4)5)19-21-22(23(26)27-11-2)29-25(6,7)28-21/h20-22H,10-19H2,1-9H3/t20-,21+,22-/m1/s1 |
| InChIKey | UAMPXMKWYVJYFR-BHIFYINESA-N |
| XLogP | 6.99 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.76 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|