C31H64O3Si2 — CID 87146248
(3R,4S)-4-[(2S)-2-[tert-butyl(dimethyl)silyl]oxynonyl]-3-(8-methylnonyl)-3-trimethylsilyloxetan-2-one (PubChem CID 87146248) has the molecular formula C31H64O3Si2 and a molecular weight of 541.02 g/mol. Its IUPAC name is (3R,4S)-4-[(2S)-2-[tert-butyl(dimethyl)silyl]oxynonyl]-3-(8-methylnonyl)-3-trimethylsilyloxetan-2-one.
| Compound Name | (3R,4S)-4-[(2S)-2-[tert-butyl(dimethyl)silyl]oxynonyl]-3-(8-methylnonyl)-3-trimethylsilyloxetan-2-one |
|---|---|
| PubChem CID | 87146248 |
| Molecular Formula | C31H64O3Si2 |
| Molecular Weight | 541.02 g/mol |
| Exact Mass | 540.44 |
| IUPAC Name | (3R,4S)-4-[(2S)-2-[tert-butyl(dimethyl)silyl]oxynonyl]-3-(8-methylnonyl)-3-trimethylsilyloxetan-2-one |
| SMILES | CCCCCCC[C@@H](C[C@@H]1OC(=O)[C@]1(CCCCCCCC(C)C)[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H64O3Si2/c1-12-13-14-16-20-23-27(34-36(10,11)30(4,5)6)25-28-31(29(32)33-28,35(7,8)9)24-21-18-15-17-19-22-26(2)3/h26-28H,12-25H2,1-11H3/t27-,28-,31+/m0/s1 |
| InChIKey | JWOWHZNKVMANNX-WAKHXKBOSA-N |
| XLogP | 10.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.02 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|