C46H85NO5Si3 — CID 57063705
(3S,6R,7S,8S,15S)-3,7,15-tris[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8,12,16-hexamethyl-5-oxo-17-pyridin-2-ylheptadeca-12,16-dienal (PubChem CID 57063705) has the molecular formula C46H85NO5Si3 and a molecular weight of 816.45 g/mol. Its IUPAC name is (3S,6R,7S,8S,15S)-3,7,15-tris[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8,12,16-hexamethyl-5-oxo-17-pyridin-2-ylheptadeca-12,16-dienal.
| Compound Name | (3S,6R,7S,8S,15S)-3,7,15-tris[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8,12,16-hexamethyl-5-oxo-17-pyridin-2-ylheptadeca-12,16-dienal |
|---|---|
| PubChem CID | 57063705 |
| Molecular Formula | C46H85NO5Si3 |
| Molecular Weight | 816.45 g/mol |
| Exact Mass | 815.57 |
| IUPAC Name | (3S,6R,7S,8S,15S)-3,7,15-tris[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8,12,16-hexamethyl-5-oxo-17-pyridin-2-ylheptadeca-12,16-dienal |
| SMILES | CC(=CC[C@H](O[Si](C)(C)C(C)(C)C)C(C)=Cc1ccccn1)CCC[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)C(C)(C)[C@H](CC=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C46H85NO5Si3/c1-34(28-29-39(50-53(16,17)43(5,6)7)36(3)33-38-27-22-23-31-47-38)25-24-26-35(2)41(52-55(20,21)45(11,12)13)37(4)42(49)46(14,15)40(30-32-48)51-54(18,19)44(8,9)10/h22-23,27-28,31-33,35,37,39-41H,24-26,29-30H2,1-21H3/t35-,37+,39-,40-,41-/m0/s1 |
| InChIKey | AYZZXQCJXAXESC-GCKCWUSBSA-N |
| XLogP | 13.62 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.45 |
| LogP ≤ 5 | 13.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|