C14H21NO3S — CID 18739761
[3-[(E)-2-methoxy-3-methyl-4-(2-methyl-1,3-thiazol-4-yl)but-3-enyl]-2-methyloxiran-2-yl]methanol (PubChem CID 18739761) has the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. Its IUPAC name is [3-[(E)-2-methoxy-3-methyl-4-(2-methyl-1,3-thiazol-4-yl)but-3-enyl]-2-methyloxiran-2-yl]methanol.
| Compound Name | [3-[(E)-2-methoxy-3-methyl-4-(2-methyl-1,3-thiazol-4-yl)but-3-enyl]-2-methyloxiran-2-yl]methanol |
|---|---|
| PubChem CID | 18739761 |
| Molecular Formula | C14H21NO3S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | [3-[(E)-2-methoxy-3-methyl-4-(2-methyl-1,3-thiazol-4-yl)but-3-enyl]-2-methyloxiran-2-yl]methanol |
| SMILES | COC(CC1OC1(C)CO)/C(C)=C/c1csc(C)n1 |
| InChI | InChI=1S/C14H21NO3S/c1-9(5-11-7-19-10(2)15-11)12(17-4)6-13-14(3,8-16)18-13/h5,7,12-13,16H,6,8H2,1-4H3/b9-5+ |
| InChIKey | DAJIAQOITHFLNC-WEVVVXLNSA-N |
| XLogP | 2.41 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|