C13H18I2NOSY- — CID 160666379
4-[(1E)-3-methoxy-2-methylhepta-1,5-dienyl]-2-methyl-1,3-thiazole;molecular iodine;yttrium (PubChem CID 160666379) has the molecular formula C13H18I2NOSY- and a molecular weight of 579.07 g/mol. Its IUPAC name is 4-[(1E)-3-methoxy-2-methylhepta-1,5-dienyl]-2-methyl-1,3-thiazole;molecular iodine;yttrium.
| Compound Name | 4-[(1E)-3-methoxy-2-methylhepta-1,5-dienyl]-2-methyl-1,3-thiazole;molecular iodine;yttrium |
|---|---|
| PubChem CID | 160666379 |
| Molecular Formula | C13H18I2NOSY- |
| Molecular Weight | 579.07 g/mol |
| Exact Mass | 578.83 |
| IUPAC Name | 4-[(1E)-3-methoxy-2-methylhepta-1,5-dienyl]-2-methyl-1,3-thiazole;molecular iodine;yttrium |
| SMILES | C/[C-]=C\CC(OC)/C(C)=C/c1csc(C)n1.II.[Y] |
| InChI | InChI=1S/C13H18NOS.I2.Y/c1-5-6-7-13(15-4)10(2)8-12-9-16-11(3)14-12;1-2;/h6,8-9,13H,7H2,1-4H3;;/q-1;;/b10-8+;; |
| InChIKey | ZLROBKPTZQZYLZ-PIHABLKOSA-N |
| XLogP | 5.41 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.07 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|