C16H26NO2OsSSi — CID 173271111
(3R)-4-methyl-5-(2-methyl-1,3-thiazol-4-yl)-3-triethylsilyloxypent-4-en-1-one;osmium(1+) (PubChem CID 173271111) has the molecular formula C16H26NO2OsSSi and a molecular weight of 514.77 g/mol. Its IUPAC name is (3R)-4-methyl-5-(2-methyl-1,3-thiazol-4-yl)-3-triethylsilyloxypent-4-en-1-one;osmium(1+).
| Compound Name | (3R)-4-methyl-5-(2-methyl-1,3-thiazol-4-yl)-3-triethylsilyloxypent-4-en-1-one;osmium(1+) |
|---|---|
| PubChem CID | 173271111 |
| Molecular Formula | C16H26NO2OsSSi |
| Molecular Weight | 514.77 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | (3R)-4-methyl-5-(2-methyl-1,3-thiazol-4-yl)-3-triethylsilyloxypent-4-en-1-one;osmium(1+) |
| SMILES | CC[Si](CC)(CC)O[C@H](C[C-]=O)C(C)=Cc1csc(C)n1.[Os+] |
| InChI | InChI=1S/C16H26NO2SSi.Os/c1-6-21(7-2,8-3)19-16(9-10-18)13(4)11-15-12-20-14(5)17-15;/h11-12,16H,6-9H2,1-5H3;/q-1;+1/t16-;/m1./s1 |
| InChIKey | UDNRMBCIXMEZQM-PKLMIRHRSA-N |
| XLogP | 4.74 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.77 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|