C9H13NS — CID 74067620
2-methyl-4-(2-methylbut-1-enyl)-1,3-thiazole (PubChem CID 74067620) has the molecular formula C9H13NS and a molecular weight of 167.28 g/mol. Its IUPAC name is 2-methyl-4-(2-methylbut-1-enyl)-1,3-thiazole.
| Compound Name | 2-methyl-4-(2-methylbut-1-enyl)-1,3-thiazole |
|---|---|
| PubChem CID | 74067620 |
| Molecular Formula | C9H13NS |
| Molecular Weight | 167.28 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | 2-methyl-4-(2-methylbut-1-enyl)-1,3-thiazole |
| SMILES | CCC(C)=Cc1csc(C)n1 |
| InChI | InChI=1S/C9H13NS/c1-4-7(2)5-9-6-11-8(3)10-9/h5-6H,4H2,1-3H3 |
| InChIKey | HGJXWAJLDAGMLY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.28 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |