C10H14FNS — CID 142012890
4-[(Z)-2-fluorohex-1-enyl]-2-methyl-1,3-thiazole (PubChem CID 142012890) has the molecular formula C10H14FNS and a molecular weight of 199.29 g/mol. Its IUPAC name is 4-[(Z)-2-fluorohex-1-enyl]-2-methyl-1,3-thiazole.
| Compound Name | 4-[(Z)-2-fluorohex-1-enyl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 142012890 |
| Molecular Formula | C10H14FNS |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 4-[(Z)-2-fluorohex-1-enyl]-2-methyl-1,3-thiazole |
| SMILES | CCCC/C(F)=C/c1csc(C)n1 |
| InChI | InChI=1S/C10H14FNS/c1-3-4-5-9(11)6-10-7-13-8(2)12-10/h6-7H,3-5H2,1-2H3/b9-6- |
| InChIKey | CWGVWRQMHCDMEW-TWGQIWQCSA-N |
| XLogP | 3.95 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |