C7H8BrNS — CID 177461796
4-[(Z)-2-bromoprop-1-enyl]-2-methyl-1,3-thiazole (PubChem CID 177461796) has the molecular formula C7H8BrNS and a molecular weight of 218.12 g/mol. Its IUPAC name is 4-[(Z)-2-bromoprop-1-enyl]-2-methyl-1,3-thiazole.
| Compound Name | 4-[(Z)-2-bromoprop-1-enyl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 177461796 |
| Molecular Formula | C7H8BrNS |
| Molecular Weight | 218.12 g/mol |
| Exact Mass | 216.96 |
| IUPAC Name | 4-[(Z)-2-bromoprop-1-enyl]-2-methyl-1,3-thiazole |
| SMILES | C/C(Br)=C/c1csc(C)n1 |
| InChI | InChI=1S/C7H8BrNS/c1-5(8)3-7-4-10-6(2)9-7/h3-4H,1-2H3/b5-3- |
| InChIKey | CJZFATHDPISQNK-HYXAFXHYSA-N |
| XLogP | 3.21 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.12 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |