C9H11NOS — CID 71356711
3-methyl-4-(2-methyl-1,3-thiazol-4-yl)but-3-en-2-one (PubChem CID 71356711) has the molecular formula C9H11NOS and a molecular weight of 181.26 g/mol. Its IUPAC name is 3-methyl-4-(2-methyl-1,3-thiazol-4-yl)but-3-en-2-one.
| Compound Name | 3-methyl-4-(2-methyl-1,3-thiazol-4-yl)but-3-en-2-one |
|---|---|
| PubChem CID | 71356711 |
| Molecular Formula | C9H11NOS |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | 3-methyl-4-(2-methyl-1,3-thiazol-4-yl)but-3-en-2-one |
| SMILES | CC(=O)C(C)=Cc1csc(C)n1 |
| InChI | InChI=1S/C9H11NOS/c1-6(7(2)11)4-9-5-12-8(3)10-9/h4-5H,1-3H3 |
| InChIKey | UTCIZANXNOHRHG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|