C19H29NO2S — CID 101129993
(4R,8Z,11S,12E)-11-hydroxy-4,12-dimethyl-13-(2-methyl-1,3-thiazol-4-yl)trideca-8,12-dien-3-one (PubChem CID 101129993) has the molecular formula C19H29NO2S and a molecular weight of 335.51 g/mol. Its IUPAC name is (4R,8Z,11S,12E)-11-hydroxy-4,12-dimethyl-13-(2-methyl-1,3-thiazol-4-yl)trideca-8,12-dien-3-one.
| Compound Name | (4R,8Z,11S,12E)-11-hydroxy-4,12-dimethyl-13-(2-methyl-1,3-thiazol-4-yl)trideca-8,12-dien-3-one |
|---|---|
| PubChem CID | 101129993 |
| Molecular Formula | C19H29NO2S |
| Molecular Weight | 335.51 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | (4R,8Z,11S,12E)-11-hydroxy-4,12-dimethyl-13-(2-methyl-1,3-thiazol-4-yl)trideca-8,12-dien-3-one |
| SMILES | CCC(=O)[C@H](C)CCC/C=C\C[C@H](O)/C(C)=C/c1csc(C)n1 |
| InChI | InChI=1S/C19H29NO2S/c1-5-18(21)14(2)10-8-6-7-9-11-19(22)15(3)12-17-13-23-16(4)20-17/h7,9,12-14,19,22H,5-6,8,10-11H2,1-4H3/b9-7-,15-12+/t14-,19+/m1/s1 |
| InChIKey | JSKPINUBZQXMGD-DMUFHSQTSA-N |
| XLogP | 4.95 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.51 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|