C14H19NO2S — CID 101057780
(1E,3R,6E)-3-hydroxy-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)nona-1,6-dien-5-one (PubChem CID 101057780) has the molecular formula C14H19NO2S and a molecular weight of 265.38 g/mol. Its IUPAC name is (1E,3R,6E)-3-hydroxy-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)nona-1,6-dien-5-one.
| Compound Name | (1E,3R,6E)-3-hydroxy-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)nona-1,6-dien-5-one |
|---|---|
| PubChem CID | 101057780 |
| Molecular Formula | C14H19NO2S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | (1E,3R,6E)-3-hydroxy-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)nona-1,6-dien-5-one |
| SMILES | CC/C=C/C(=O)C[C@@H](O)/C(C)=C/c1csc(C)n1 |
| InChI | InChI=1S/C14H19NO2S/c1-4-5-6-13(16)8-14(17)10(2)7-12-9-18-11(3)15-12/h5-7,9,14,17H,4,8H2,1-3H3/b6-5+,10-7+/t14-/m1/s1 |
| InChIKey | BCWIOFZBMVMAGS-NAKAFRPHSA-N |
| XLogP | 3.14 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|