C29H47NOS — CID 154164217
2,2,3,3-tetramethyl-18-(2-methyl-1,3-thiazol-4-yl)-7-prop-2-enyloctadeca-13,17-dien-6-one (PubChem CID 154164217) has the molecular formula C29H47NOS and a molecular weight of 457.77 g/mol. Its IUPAC name is 2,2,3,3-tetramethyl-18-(2-methyl-1,3-thiazol-4-yl)-7-prop-2-enyloctadeca-13,17-dien-6-one.
| Compound Name | 2,2,3,3-tetramethyl-18-(2-methyl-1,3-thiazol-4-yl)-7-prop-2-enyloctadeca-13,17-dien-6-one |
|---|---|
| PubChem CID | 154164217 |
| Molecular Formula | C29H47NOS |
| Molecular Weight | 457.77 g/mol |
| Exact Mass | 457.34 |
| IUPAC Name | 2,2,3,3-tetramethyl-18-(2-methyl-1,3-thiazol-4-yl)-7-prop-2-enyloctadeca-13,17-dien-6-one |
| SMILES | C=CCC(CCCCCC=CCCC=Cc1csc(C)n1)C(=O)CCC(C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H47NOS/c1-8-18-25(27(31)21-22-29(6,7)28(3,4)5)19-16-14-12-10-9-11-13-15-17-20-26-23-32-24(2)30-26/h8-9,11,17,20,23,25H,1,10,12-16,18-19,21-22H2,2-7H3 |
| InChIKey | BCDSSWHDJVFABF-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.77 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|