C19H30N2OS — CID 91382848
5-(2-methyl-1,3-thiazol-4-yl)pentadeca-10,14-dienamide (PubChem CID 91382848) has the molecular formula C19H30N2OS and a molecular weight of 334.53 g/mol. Its IUPAC name is 5-(2-methyl-1,3-thiazol-4-yl)pentadeca-10,14-dienamide.
| Compound Name | 5-(2-methyl-1,3-thiazol-4-yl)pentadeca-10,14-dienamide |
|---|---|
| PubChem CID | 91382848 |
| Molecular Formula | C19H30N2OS |
| Molecular Weight | 334.53 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 5-(2-methyl-1,3-thiazol-4-yl)pentadeca-10,14-dienamide |
| SMILES | C=CCCC=CCCCCC(CCCC(N)=O)c1csc(C)n1 |
| InChI | InChI=1S/C19H30N2OS/c1-3-4-5-6-7-8-9-10-12-17(13-11-14-19(20)22)18-15-23-16(2)21-18/h3,6-7,15,17H,1,4-5,8-14H2,2H3,(H2,20,22) |
| InChIKey | UHSXMHOWWMELHU-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|