C35H60N2O3S2Si2 — CID 91460624
1,5-bis[5-[butyl(dimethyl)silyl]oxy-2-methyl-1,3-thiazol-4-yl]pentadeca-10,14-dien-1-one (PubChem CID 91460624) has the molecular formula C35H60N2O3S2Si2 and a molecular weight of 677.18 g/mol. Its IUPAC name is 1,5-bis[5-[butyl(dimethyl)silyl]oxy-2-methyl-1,3-thiazol-4-yl]pentadeca-10,14-dien-1-one.
| Compound Name | 1,5-bis[5-[butyl(dimethyl)silyl]oxy-2-methyl-1,3-thiazol-4-yl]pentadeca-10,14-dien-1-one |
|---|---|
| PubChem CID | 91460624 |
| Molecular Formula | C35H60N2O3S2Si2 |
| Molecular Weight | 677.18 g/mol |
| Exact Mass | 676.36 |
| IUPAC Name | 1,5-bis[5-[butyl(dimethyl)silyl]oxy-2-methyl-1,3-thiazol-4-yl]pentadeca-10,14-dien-1-one |
| SMILES | C=CCCC=CCCCCC(CCCC(=O)c1nc(C)sc1O[Si](C)(C)CCCC)c1nc(C)sc1O[Si](C)(C)CCCC |
| InChI | InChI=1S/C35H60N2O3S2Si2/c1-10-13-16-17-18-19-20-21-23-30(32-34(41-28(4)36-32)39-43(6,7)26-14-11-2)24-22-25-31(38)33-35(42-29(5)37-33)40-44(8,9)27-15-12-3/h10,17-18,30H,1,11-16,19-27H2,2-9H3 |
| InChIKey | QUNRRBDSPUDRCB-UHFFFAOYSA-N |
| XLogP | 12.20 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.18 |
| LogP ≤ 5 | 12.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|